Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Recommanded Product: Tetrazolium Red, 298-96-4, Name is Tetrazolium Red, SMILES is [N+]1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=NN1C4=CC=CC=C4.[Cl-], belongs to naphthyridine compound. In a document, author is Ehlers, Peter, introduce the new discover.
Suzuki-Miyaura Reactions of 2,7-Dichloro-1,8-naphthyridine
2,7-Diaryl- and 2,7-dialkenyl-1,8-naphthyridines were prepared in high yields by Suzuki-Miyaura reactions of 2,7-dichloro-1,8-naphthyridines. While most of the products proved to be not or only weakly fluorescent, we observed a strong fluorescence in case of 2,7-bis(4-methoxyphenyl)-1,8-naphthyridine containing two electron-donating aryl groups.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 298-96-4 is helpful to your research. Recommanded Product: Tetrazolium Red.
Reference:
1,8-Naphthyridine – Wikipedia,
,1,8-Naphthyridine | C8H6N2 – PubChem